C26H33N3O4 — CID 46023429
3-methoxy-N-(3-methoxypropyl)-N-[[5-[methyl(propan-2-yl)amino]-3-phenyl-1,2-oxazol-4-yl]methyl]benzamide (PubChem CID 46023429) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is 3-methoxy-N-(3-methoxypropyl)-N-[[5-[methyl(propan-2-yl)amino]-3-phenyl-1,2-oxazol-4-yl]methyl]benzamide.
| Compound Name | 3-methoxy-N-(3-methoxypropyl)-N-[[5-[methyl(propan-2-yl)amino]-3-phenyl-1,2-oxazol-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 46023429 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 3-methoxy-N-(3-methoxypropyl)-N-[[5-[methyl(propan-2-yl)amino]-3-phenyl-1,2-oxazol-4-yl]methyl]benzamide |
| SMILES | COCCCN(Cc1c(-c2ccccc2)noc1N(C)C(C)C)C(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C26H33N3O4/c1-19(2)28(3)26-23(24(27-33-26)20-11-7-6-8-12-20)18-29(15-10-16-31-4)25(30)21-13-9-14-22(17-21)32-5/h6-9,11-14,17,19H,10,15-16,18H2,1-5H3 |
| InChIKey | BPOMUPQSEQQXRG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 68.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|