C26H30ClN3O3 — CID 46025502
1-[[1-(3-chlorophenyl)-3-methyl-5-phenoxypyrazol-4-yl]methyl-cyclopropylamino]-3-prop-2-enoxypropan-2-ol (PubChem CID 46025502) has the molecular formula C26H30ClN3O3 and a molecular weight of 468.00 g/mol. Its IUPAC name is 1-[[1-(3-chlorophenyl)-3-methyl-5-phenoxypyrazol-4-yl]methyl-cyclopropylamino]-3-prop-2-enoxypropan-2-ol.
| Compound Name | 1-[[1-(3-chlorophenyl)-3-methyl-5-phenoxypyrazol-4-yl]methyl-cyclopropylamino]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 46025502 |
| Molecular Formula | C26H30ClN3O3 |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 1-[[1-(3-chlorophenyl)-3-methyl-5-phenoxypyrazol-4-yl]methyl-cyclopropylamino]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOCC(O)CN(Cc1c(C)nn(-c2cccc(Cl)c2)c1Oc1ccccc1)C1CC1 |
| InChI | InChI=1S/C26H30ClN3O3/c1-3-14-32-18-23(31)16-29(21-12-13-21)17-25-19(2)28-30(22-9-7-8-20(27)15-22)26(25)33-24-10-5-4-6-11-24/h3-11,15,21,23,31H,1,12-14,16-18H2,2H3 |
| InChIKey | ULEIPPZFRFNQOW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|