C28H36ClN3O3 — CID 93222897
(2S)-1-butoxy-3-[[1-(3-chlorophenyl)-3-methyl-5-phenoxypyrazol-4-yl]methyl-(cyclopropylmethyl)amino]propan-2-ol (PubChem CID 93222897) has the molecular formula C28H36ClN3O3 and a molecular weight of 498.07 g/mol. Its IUPAC name is (2S)-1-butoxy-3-[[1-(3-chlorophenyl)-3-methyl-5-phenoxypyrazol-4-yl]methyl-(cyclopropylmethyl)amino]propan-2-ol.
| Compound Name | (2S)-1-butoxy-3-[[1-(3-chlorophenyl)-3-methyl-5-phenoxypyrazol-4-yl]methyl-(cyclopropylmethyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 93222897 |
| Molecular Formula | C28H36ClN3O3 |
| Molecular Weight | 498.07 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | (2S)-1-butoxy-3-[[1-(3-chlorophenyl)-3-methyl-5-phenoxypyrazol-4-yl]methyl-(cyclopropylmethyl)amino]propan-2-ol |
| SMILES | CCCCOC[C@@H](O)CN(Cc1c(C)nn(-c2cccc(Cl)c2)c1Oc1ccccc1)CC1CC1 |
| InChI | InChI=1S/C28H36ClN3O3/c1-3-4-15-34-20-25(33)18-31(17-22-13-14-22)19-27-21(2)30-32(24-10-8-9-23(29)16-24)28(27)35-26-11-6-5-7-12-26/h5-12,16,22,25,33H,3-4,13-15,17-20H2,1-2H3/t25-/m0/s1 |
| InChIKey | SAUPBZDTCOZYDY-VWLOTQADSA-N |
| XLogP | 6.02 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.07 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|