C28H33N3O4 — CID 46025987
1-[cyclopropylmethyl-[[5-(4-methoxyphenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl]amino]-3-prop-2-ynoxypropan-2-ol (PubChem CID 46025987) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is 1-[cyclopropylmethyl-[[5-(4-methoxyphenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl]amino]-3-prop-2-ynoxypropan-2-ol.
| Compound Name | 1-[cyclopropylmethyl-[[5-(4-methoxyphenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl]amino]-3-prop-2-ynoxypropan-2-ol |
|---|---|
| PubChem CID | 46025987 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 1-[cyclopropylmethyl-[[5-(4-methoxyphenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl]amino]-3-prop-2-ynoxypropan-2-ol |
| SMILES | C#CCOCC(O)CN(Cc1c(C)nn(-c2ccccc2)c1Oc1ccc(OC)cc1)CC1CC1 |
| InChI | InChI=1S/C28H33N3O4/c1-4-16-34-20-24(32)18-30(17-22-10-11-22)19-27-21(2)29-31(23-8-6-5-7-9-23)28(27)35-26-14-12-25(33-3)13-15-26/h1,5-9,12-15,22,24,32H,10-11,16-20H2,2-3H3 |
| InChIKey | MSCHRNYXDSSXSK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 68.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|