C28H32FN3O4 — CID 46030293
1-[[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl-(oxolan-2-ylmethyl)amino]-3-prop-2-ynoxypropan-2-ol (PubChem CID 46030293) has the molecular formula C28H32FN3O4 and a molecular weight of 493.58 g/mol. Its IUPAC name is 1-[[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl-(oxolan-2-ylmethyl)amino]-3-prop-2-ynoxypropan-2-ol.
| Compound Name | 1-[[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl-(oxolan-2-ylmethyl)amino]-3-prop-2-ynoxypropan-2-ol |
|---|---|
| PubChem CID | 46030293 |
| Molecular Formula | C28H32FN3O4 |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 1-[[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl-(oxolan-2-ylmethyl)amino]-3-prop-2-ynoxypropan-2-ol |
| SMILES | C#CCOCC(O)CN(Cc1c(C)nn(-c2ccccc2)c1Oc1ccc(F)cc1)CC1CCCO1 |
| InChI | InChI=1S/C28H32FN3O4/c1-3-15-34-20-24(33)17-31(18-26-10-7-16-35-26)19-27-21(2)30-32(23-8-5-4-6-9-23)28(27)36-25-13-11-22(29)12-14-25/h1,4-6,8-9,11-14,24,26,33H,7,10,15-20H2,2H3 |
| InChIKey | GVMFAQZACUDFHN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 68.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|