C29H37F2N3O4 — CID 93222939
(2S)-1-butoxy-3-[[5-(2,4-difluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl-[[(2S)-oxolan-2-yl]methyl]amino]propan-2-ol (PubChem CID 93222939) has the molecular formula C29H37F2N3O4 and a molecular weight of 529.63 g/mol. Its IUPAC name is (2S)-1-butoxy-3-[[5-(2,4-difluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl-[[(2S)-oxolan-2-yl]methyl]amino]propan-2-ol.
| Compound Name | (2S)-1-butoxy-3-[[5-(2,4-difluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl-[[(2S)-oxolan-2-yl]methyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 93222939 |
| Molecular Formula | C29H37F2N3O4 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | (2S)-1-butoxy-3-[[5-(2,4-difluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl-[[(2S)-oxolan-2-yl]methyl]amino]propan-2-ol |
| SMILES | CCCCOC[C@@H](O)CN(Cc1c(C)nn(-c2ccccc2)c1Oc1ccc(F)cc1F)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C29H37F2N3O4/c1-3-4-14-36-20-24(35)17-33(18-25-11-8-15-37-25)19-26-21(2)32-34(23-9-6-5-7-10-23)29(26)38-28-13-12-22(30)16-27(28)31/h5-7,9-10,12-13,16,24-25,35H,3-4,8,11,14-15,17-20H2,1-2H3/t24-,25-/m0/s1 |
| InChIKey | SMDDWHJQJCJJKN-DQEYMECFSA-N |
| XLogP | 5.41 |
| TPSA | 68.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|