C28H35N3O4 — CID 46026206
1-[butan-2-yl-[[5-(2-methoxyphenoxy)-1-methyl-3-phenylpyrazol-4-yl]methyl]amino]-3-prop-2-ynoxypropan-2-ol (PubChem CID 46026206) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is 1-[butan-2-yl-[[5-(2-methoxyphenoxy)-1-methyl-3-phenylpyrazol-4-yl]methyl]amino]-3-prop-2-ynoxypropan-2-ol.
| Compound Name | 1-[butan-2-yl-[[5-(2-methoxyphenoxy)-1-methyl-3-phenylpyrazol-4-yl]methyl]amino]-3-prop-2-ynoxypropan-2-ol |
|---|---|
| PubChem CID | 46026206 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | 1-[butan-2-yl-[[5-(2-methoxyphenoxy)-1-methyl-3-phenylpyrazol-4-yl]methyl]amino]-3-prop-2-ynoxypropan-2-ol |
| SMILES | C#CCOCC(O)CN(Cc1c(-c2ccccc2)nn(C)c1Oc1ccccc1OC)C(C)CC |
| InChI | InChI=1S/C28H35N3O4/c1-6-17-34-20-23(32)18-31(21(3)7-2)19-24-27(22-13-9-8-10-14-22)29-30(4)28(24)35-26-16-12-11-15-25(26)33-5/h1,8-16,21,23,32H,7,17-20H2,2-5H3 |
| InChIKey | VVAKLWUEPGMVDB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 68.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|