C26H32ClN3O3 — CID 93224584
(2R)-1-[[5-(2-chlorophenoxy)-1-methyl-3-phenylpyrazol-4-yl]methyl-propan-2-ylamino]-3-prop-2-enoxypropan-2-ol (PubChem CID 93224584) has the molecular formula C26H32ClN3O3 and a molecular weight of 470.01 g/mol. Its IUPAC name is (2R)-1-[[5-(2-chlorophenoxy)-1-methyl-3-phenylpyrazol-4-yl]methyl-propan-2-ylamino]-3-prop-2-enoxypropan-2-ol.
| Compound Name | (2R)-1-[[5-(2-chlorophenoxy)-1-methyl-3-phenylpyrazol-4-yl]methyl-propan-2-ylamino]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 93224584 |
| Molecular Formula | C26H32ClN3O3 |
| Molecular Weight | 470.01 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | (2R)-1-[[5-(2-chlorophenoxy)-1-methyl-3-phenylpyrazol-4-yl]methyl-propan-2-ylamino]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOC[C@H](O)CN(Cc1c(-c2ccccc2)nn(C)c1Oc1ccccc1Cl)C(C)C |
| InChI | InChI=1S/C26H32ClN3O3/c1-5-15-32-18-21(31)16-30(19(2)3)17-22-25(20-11-7-6-8-12-20)28-29(4)26(22)33-24-14-10-9-13-23(24)27/h5-14,19,21,31H,1,15-18H2,2-4H3/t21-/m1/s1 |
| InChIKey | NGVRVKOWWZIYCQ-OAQYLSRUSA-N |
| XLogP | 5.31 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.01 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|