C26H32N2O4S — CID 46026817
2-[cyclopropyl-(2-hydroxy-3-prop-2-ynoxypropyl)amino]-1-[4-[(4-methylphenoxy)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethanone (PubChem CID 46026817) has the molecular formula C26H32N2O4S and a molecular weight of 468.62 g/mol. Its IUPAC name is 2-[cyclopropyl-(2-hydroxy-3-prop-2-ynoxypropyl)amino]-1-[4-[(4-methylphenoxy)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethanone.
| Compound Name | 2-[cyclopropyl-(2-hydroxy-3-prop-2-ynoxypropyl)amino]-1-[4-[(4-methylphenoxy)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethanone |
|---|---|
| PubChem CID | 46026817 |
| Molecular Formula | C26H32N2O4S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 2-[cyclopropyl-(2-hydroxy-3-prop-2-ynoxypropyl)amino]-1-[4-[(4-methylphenoxy)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethanone |
| SMILES | C#CCOCC(O)CN(CC(=O)N1CCc2sccc2C1COc1ccc(C)cc1)C1CC1 |
| InChI | InChI=1S/C26H32N2O4S/c1-3-13-31-17-21(29)15-27(20-6-7-20)16-26(30)28-12-10-25-23(11-14-33-25)24(28)18-32-22-8-4-19(2)5-9-22/h1,4-5,8-9,11,14,20-21,24,29H,6-7,10,12-13,15-18H2,2H3 |
| InChIKey | DIQGBFQZMLIWAW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|