C26H34N2O5S — CID 46027153
2-[(2-hydroxy-3-prop-2-ynoxypropyl)-propylamino]-1-[4-[(4-methoxyphenoxy)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethanone (PubChem CID 46027153) has the molecular formula C26H34N2O5S and a molecular weight of 486.63 g/mol. Its IUPAC name is 2-[(2-hydroxy-3-prop-2-ynoxypropyl)-propylamino]-1-[4-[(4-methoxyphenoxy)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethanone.
| Compound Name | 2-[(2-hydroxy-3-prop-2-ynoxypropyl)-propylamino]-1-[4-[(4-methoxyphenoxy)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethanone |
|---|---|
| PubChem CID | 46027153 |
| Molecular Formula | C26H34N2O5S |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 2-[(2-hydroxy-3-prop-2-ynoxypropyl)-propylamino]-1-[4-[(4-methoxyphenoxy)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethanone |
| SMILES | C#CCOCC(O)CN(CCC)CC(=O)N1CCc2sccc2C1COc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H34N2O5S/c1-4-12-27(16-20(29)18-32-14-5-2)17-26(30)28-13-10-25-23(11-15-34-25)24(28)19-33-22-8-6-21(31-3)7-9-22/h2,6-9,11,15,20,24,29H,4,10,12-14,16-19H2,1,3H3 |
| InChIKey | XYGBKVKSCASETJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|