C20H21F2NO2 — CID 46029061
1-[3-[(2,5-difluorophenyl)methoxy]piperidin-1-yl]-2-phenylethanone (PubChem CID 46029061) has the molecular formula C20H21F2NO2 and a molecular weight of 345.39 g/mol. Its IUPAC name is 1-[3-[(2,5-difluorophenyl)methoxy]piperidin-1-yl]-2-phenylethanone.
| Compound Name | 1-[3-[(2,5-difluorophenyl)methoxy]piperidin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 46029061 |
| Molecular Formula | C20H21F2NO2 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 1-[3-[(2,5-difluorophenyl)methoxy]piperidin-1-yl]-2-phenylethanone |
| SMILES | O=C(Cc1ccccc1)N1CCCC(OCc2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C20H21F2NO2/c21-17-8-9-19(22)16(12-17)14-25-18-7-4-10-23(13-18)20(24)11-15-5-2-1-3-6-15/h1-3,5-6,8-9,12,18H,4,7,10-11,13-14H2 |
| InChIKey | SCQXLJSNGWEDMU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |