C28H35N3O2 — CID 46029359
1-[cyclopropylmethyl-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl]amino]hex-5-en-2-ol (PubChem CID 46029359) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is 1-[cyclopropylmethyl-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl]amino]hex-5-en-2-ol.
| Compound Name | 1-[cyclopropylmethyl-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl]amino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 46029359 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 1-[cyclopropylmethyl-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl]amino]hex-5-en-2-ol |
| SMILES | C=CCCC(O)CN(Cc1c(CC)nn(-c2ccccc2)c1Oc1ccccc1)CC1CC1 |
| InChI | InChI=1S/C28H35N3O2/c1-3-5-14-24(32)20-30(19-22-17-18-22)21-26-27(4-2)29-31(23-12-8-6-9-13-23)28(26)33-25-15-10-7-11-16-25/h3,6-13,15-16,22,24,32H,1,4-5,14,17-21H2,2H3 |
| InChIKey | WHNIARBJICOFNS-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|