C29H36FN3O2 — CID 93219888
(2S)-1-[cyclopropylmethyl-[[5-(2-fluorophenoxy)-1-phenyl-3-propan-2-ylpyrazol-4-yl]methyl]amino]hex-5-en-2-ol (PubChem CID 93219888) has the molecular formula C29H36FN3O2 and a molecular weight of 477.62 g/mol. Its IUPAC name is (2S)-1-[cyclopropylmethyl-[[5-(2-fluorophenoxy)-1-phenyl-3-propan-2-ylpyrazol-4-yl]methyl]amino]hex-5-en-2-ol.
| Compound Name | (2S)-1-[cyclopropylmethyl-[[5-(2-fluorophenoxy)-1-phenyl-3-propan-2-ylpyrazol-4-yl]methyl]amino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 93219888 |
| Molecular Formula | C29H36FN3O2 |
| Molecular Weight | 477.62 g/mol |
| Exact Mass | 477.28 |
| IUPAC Name | (2S)-1-[cyclopropylmethyl-[[5-(2-fluorophenoxy)-1-phenyl-3-propan-2-ylpyrazol-4-yl]methyl]amino]hex-5-en-2-ol |
| SMILES | C=CCC[C@H](O)CN(Cc1c(C(C)C)nn(-c2ccccc2)c1Oc1ccccc1F)CC1CC1 |
| InChI | InChI=1S/C29H36FN3O2/c1-4-5-13-24(34)19-32(18-22-16-17-22)20-25-28(21(2)3)31-33(23-11-7-6-8-12-23)29(25)35-27-15-10-9-14-26(27)30/h4,6-12,14-15,21-22,24,34H,1,5,13,16-20H2,2-3H3/t24-/m0/s1 |
| InChIKey | ONYHDSBRAOCGCY-DEOSSOPVSA-N |
| XLogP | 6.47 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.62 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|