C31H37N3O2 — CID 46032111
1-[benzyl-[[1-methyl-5-(4-methylphenoxy)-3-phenylpyrazol-4-yl]methyl]amino]hexan-2-ol (PubChem CID 46032111) has the molecular formula C31H37N3O2 and a molecular weight of 483.66 g/mol. Its IUPAC name is 1-[benzyl-[[1-methyl-5-(4-methylphenoxy)-3-phenylpyrazol-4-yl]methyl]amino]hexan-2-ol.
| Compound Name | 1-[benzyl-[[1-methyl-5-(4-methylphenoxy)-3-phenylpyrazol-4-yl]methyl]amino]hexan-2-ol |
|---|---|
| PubChem CID | 46032111 |
| Molecular Formula | C31H37N3O2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | 1-[benzyl-[[1-methyl-5-(4-methylphenoxy)-3-phenylpyrazol-4-yl]methyl]amino]hexan-2-ol |
| SMILES | CCCCC(O)CN(Cc1ccccc1)Cc1c(-c2ccccc2)nn(C)c1Oc1ccc(C)cc1 |
| InChI | InChI=1S/C31H37N3O2/c1-4-5-16-27(35)22-34(21-25-12-8-6-9-13-25)23-29-30(26-14-10-7-11-15-26)32-33(3)31(29)36-28-19-17-24(2)18-20-28/h6-15,17-20,27,35H,4-5,16,21-23H2,1-3H3 |
| InChIKey | KIWLJXMOGOOHCN-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |