C28H35N3O2 — CID 93224164
(2R)-1-[cyclopropylmethyl-[[1-methyl-5-(4-methylphenoxy)-3-phenylpyrazol-4-yl]methyl]amino]hex-5-en-2-ol (PubChem CID 93224164) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is (2R)-1-[cyclopropylmethyl-[[1-methyl-5-(4-methylphenoxy)-3-phenylpyrazol-4-yl]methyl]amino]hex-5-en-2-ol.
| Compound Name | (2R)-1-[cyclopropylmethyl-[[1-methyl-5-(4-methylphenoxy)-3-phenylpyrazol-4-yl]methyl]amino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 93224164 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | (2R)-1-[cyclopropylmethyl-[[1-methyl-5-(4-methylphenoxy)-3-phenylpyrazol-4-yl]methyl]amino]hex-5-en-2-ol |
| SMILES | C=CCC[C@@H](O)CN(Cc1c(-c2ccccc2)nn(C)c1Oc1ccc(C)cc1)CC1CC1 |
| InChI | InChI=1S/C28H35N3O2/c1-4-5-11-24(32)19-31(18-22-14-15-22)20-26-27(23-9-7-6-8-10-23)29-30(3)28(26)33-25-16-12-21(2)13-17-25/h4,6-10,12-13,16-17,22,24,32H,1,5,11,14-15,18-20H2,2-3H3/t24-/m1/s1 |
| InChIKey | BDQCZTXWFXITCJ-XMMPIXPASA-N |
| XLogP | 5.73 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|