C29H37N3O3 — CID 93230601
(2R)-1-[[3-methyl-5-(4-methylphenoxy)-1-phenylpyrazol-4-yl]methyl-[[(2S)-oxolan-2-yl]methyl]amino]hex-5-en-2-ol (PubChem CID 93230601) has the molecular formula C29H37N3O3 and a molecular weight of 475.63 g/mol. Its IUPAC name is (2R)-1-[[3-methyl-5-(4-methylphenoxy)-1-phenylpyrazol-4-yl]methyl-[[(2S)-oxolan-2-yl]methyl]amino]hex-5-en-2-ol.
| Compound Name | (2R)-1-[[3-methyl-5-(4-methylphenoxy)-1-phenylpyrazol-4-yl]methyl-[[(2S)-oxolan-2-yl]methyl]amino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 93230601 |
| Molecular Formula | C29H37N3O3 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | (2R)-1-[[3-methyl-5-(4-methylphenoxy)-1-phenylpyrazol-4-yl]methyl-[[(2S)-oxolan-2-yl]methyl]amino]hex-5-en-2-ol |
| SMILES | C=CCC[C@@H](O)CN(Cc1c(C)nn(-c2ccccc2)c1Oc1ccc(C)cc1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C29H37N3O3/c1-4-5-12-25(33)19-31(20-27-13-9-18-34-27)21-28-23(3)30-32(24-10-7-6-8-11-24)29(28)35-26-16-14-22(2)15-17-26/h4,6-8,10-11,14-17,25,27,33H,1,5,9,12-13,18-21H2,2-3H3/t25-,27+/m1/s1 |
| InChIKey | BPPSIQDCNBCDTL-VPUSJEBWSA-N |
| XLogP | 5.59 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|