C23H23F3N2OS — CID 46033636
4-ethyl-6-(3-propan-2-ylphenoxy)-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]pyrimidine (PubChem CID 46033636) has the molecular formula C23H23F3N2OS and a molecular weight of 432.51 g/mol. Its IUPAC name is 4-ethyl-6-(3-propan-2-ylphenoxy)-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]pyrimidine.
| Compound Name | 4-ethyl-6-(3-propan-2-ylphenoxy)-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]pyrimidine |
|---|---|
| PubChem CID | 46033636 |
| Molecular Formula | C23H23F3N2OS |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 4-ethyl-6-(3-propan-2-ylphenoxy)-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]pyrimidine |
| SMILES | CCc1cc(Oc2cccc(C(C)C)c2)nc(SCc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C23H23F3N2OS/c1-4-19-13-21(29-20-10-6-8-17(12-20)15(2)3)28-22(27-19)30-14-16-7-5-9-18(11-16)23(24,25)26/h5-13,15H,4,14H2,1-3H3 |
| InChIKey | QWGRLEPBNMMGCZ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |