About 2-benzylsulfanyl-4-(3,5-dimethylphenoxy)-6-ethylpyrimidine
2-benzylsulfanyl-4-(3,5-dimethylphenoxy)-6-ethylpyrimidine (PubChem CID 46033420) has the molecular formula C21H22N2OS
and a molecular weight of 350.49 g/mol. Its IUPAC name is 2-benzylsulfanyl-4-(3,5-dimethylphenoxy)-6-ethylpyrimidine.
Molecular Properties
| Compound Name | 2-benzylsulfanyl-4-(3,5-dimethylphenoxy)-6-ethylpyrimidine |
| PubChem CID | 46033420 |
| Molecular Formula | C21H22N2OS |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-benzylsulfanyl-4-(3,5-dimethylphenoxy)-6-ethylpyrimidine |
| SMILES | CCc1cc(Oc2cc(C)cc(C)c2)nc(SCc2ccccc2)n1 |
| InChI | InChI=1S/C21H22N2OS/c1-4-18-13-20(24-19-11-15(2)10-16(3)12-19)23-21(22-18)25-14-17-8-6-5-7-9-17/h5-13H,4,14H2,1-3H3 |
| InChIKey | UGILPKRYNKJFFV-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-benzylsulfanyl-4-(3,5-dimethylphenoxy)-6-ethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylsulfanyl-4-(3,5-dimethylphenoxy)-6-ethylpyrimidine?
The IUPAC name of 2-benzylsulfanyl-4-(3,5-dimethylphenoxy)-6-ethylpyrimidine (CID 46033420) is 2-benzylsulfanyl-4-(3,5-dimethylphenoxy)-6-ethylpyrimidine.
What is the SMILES notation for 2-benzylsulfanyl-4-(3,5-dimethylphenoxy)-6-ethylpyrimidine?
The canonical SMILES for 2-benzylsulfanyl-4-(3,5-dimethylphenoxy)-6-ethylpyrimidine is CCc1cc(Oc2cc(C)cc(C)c2)nc(SCc2ccccc2)n1.
What is the InChIKey of 2-benzylsulfanyl-4-(3,5-dimethylphenoxy)-6-ethylpyrimidine?
The InChIKey is UGILPKRYNKJFFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2OS/c1-4-18-13-20(24-19-11-15(2)10-16(3)12-19)23-21(22-18)25-14-17-8-6-5-7-9-17/h5-13H,4,14H2,1-3H3.
What are the key properties of 2-benzylsulfanyl-4-(3,5-dimethylphenoxy)-6-ethylpyrimidine?
2-benzylsulfanyl-4-(3,5-dimethylphenoxy)-6-ethylpyrimidine has a molecular weight of 350.49 g/mol, XLogP of 5.74, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylsulfanyl-4-(3,5-dimethylphenoxy)-6-ethylpyrimidine is sourced from PubChem (CID 46033420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).