C24H28N2OS — CID 46033519
2-[(4-tert-butylphenyl)methylsulfanyl]-4-ethyl-6-(4-methylphenoxy)pyrimidine (PubChem CID 46033519) has the molecular formula C24H28N2OS and a molecular weight of 392.57 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)methylsulfanyl]-4-ethyl-6-(4-methylphenoxy)pyrimidine.
| Compound Name | 2-[(4-tert-butylphenyl)methylsulfanyl]-4-ethyl-6-(4-methylphenoxy)pyrimidine |
|---|---|
| PubChem CID | 46033519 |
| Molecular Formula | C24H28N2OS |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 2-[(4-tert-butylphenyl)methylsulfanyl]-4-ethyl-6-(4-methylphenoxy)pyrimidine |
| SMILES | CCc1cc(Oc2ccc(C)cc2)nc(SCc2ccc(C(C)(C)C)cc2)n1 |
| InChI | InChI=1S/C24H28N2OS/c1-6-20-15-22(27-21-13-7-17(2)8-14-21)26-23(25-20)28-16-18-9-11-19(12-10-18)24(3,4)5/h7-15H,6,16H2,1-5H3 |
| InChIKey | XFAUIGFSQURXLZ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |