C23H25N3O3S — CID 46033524
2-[(4-tert-butylphenyl)methylsulfanyl]-4-ethyl-6-(4-nitrophenoxy)pyrimidine (PubChem CID 46033524) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)methylsulfanyl]-4-ethyl-6-(4-nitrophenoxy)pyrimidine.
| Compound Name | 2-[(4-tert-butylphenyl)methylsulfanyl]-4-ethyl-6-(4-nitrophenoxy)pyrimidine |
|---|---|
| PubChem CID | 46033524 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 2-[(4-tert-butylphenyl)methylsulfanyl]-4-ethyl-6-(4-nitrophenoxy)pyrimidine |
| SMILES | CCc1cc(Oc2ccc([N+](=O)[O-])cc2)nc(SCc2ccc(C(C)(C)C)cc2)n1 |
| InChI | InChI=1S/C23H25N3O3S/c1-5-18-14-21(29-20-12-10-19(11-13-20)26(27)28)25-22(24-18)30-15-16-6-8-17(9-7-16)23(2,3)4/h6-14H,5,15H2,1-4H3 |
| InChIKey | KBLCRCPOJVYKGL-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|