C20H18FN3O3S — CID 42846022
4-(4-fluorophenoxy)-2-[(4-nitrophenyl)methylsulfanyl]-6-propan-2-ylpyrimidine (PubChem CID 42846022) has the molecular formula C20H18FN3O3S and a molecular weight of 399.45 g/mol. Its IUPAC name is 4-(4-fluorophenoxy)-2-[(4-nitrophenyl)methylsulfanyl]-6-propan-2-ylpyrimidine.
| Compound Name | 4-(4-fluorophenoxy)-2-[(4-nitrophenyl)methylsulfanyl]-6-propan-2-ylpyrimidine |
|---|---|
| PubChem CID | 42846022 |
| Molecular Formula | C20H18FN3O3S |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 4-(4-fluorophenoxy)-2-[(4-nitrophenyl)methylsulfanyl]-6-propan-2-ylpyrimidine |
| SMILES | CC(C)c1cc(Oc2ccc(F)cc2)nc(SCc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C20H18FN3O3S/c1-13(2)18-11-19(27-17-9-5-15(21)6-10-17)23-20(22-18)28-12-14-3-7-16(8-4-14)24(25)26/h3-11,13H,12H2,1-2H3 |
| InChIKey | VOXNAUXXDYIIEN-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|