C20H18ClFN2OS — CID 46033183
4-(4-chlorophenoxy)-2-[(4-fluorophenyl)methylsulfanyl]-6-propan-2-ylpyrimidine (PubChem CID 46033183) has the molecular formula C20H18ClFN2OS and a molecular weight of 388.90 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-2-[(4-fluorophenyl)methylsulfanyl]-6-propan-2-ylpyrimidine.
| Compound Name | 4-(4-chlorophenoxy)-2-[(4-fluorophenyl)methylsulfanyl]-6-propan-2-ylpyrimidine |
|---|---|
| PubChem CID | 46033183 |
| Molecular Formula | C20H18ClFN2OS |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 4-(4-chlorophenoxy)-2-[(4-fluorophenyl)methylsulfanyl]-6-propan-2-ylpyrimidine |
| SMILES | CC(C)c1cc(Oc2ccc(Cl)cc2)nc(SCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C20H18ClFN2OS/c1-13(2)18-11-19(25-17-9-5-15(21)6-10-17)24-20(23-18)26-12-14-3-7-16(22)8-4-14/h3-11,13H,12H2,1-2H3 |
| InChIKey | FOHFBZQYMMXQQX-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |