C21H22N2OS — CID 46033210
2-benzylsulfanyl-4-(3-methylphenoxy)-6-propan-2-ylpyrimidine (PubChem CID 46033210) has the molecular formula C21H22N2OS and a molecular weight of 350.49 g/mol. Its IUPAC name is 2-benzylsulfanyl-4-(3-methylphenoxy)-6-propan-2-ylpyrimidine.
| Compound Name | 2-benzylsulfanyl-4-(3-methylphenoxy)-6-propan-2-ylpyrimidine |
|---|---|
| PubChem CID | 46033210 |
| Molecular Formula | C21H22N2OS |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-benzylsulfanyl-4-(3-methylphenoxy)-6-propan-2-ylpyrimidine |
| SMILES | Cc1cccc(Oc2cc(C(C)C)nc(SCc3ccccc3)n2)c1 |
| InChI | InChI=1S/C21H22N2OS/c1-15(2)19-13-20(24-18-11-7-8-16(3)12-18)23-21(22-19)25-14-17-9-5-4-6-10-17/h4-13,15H,14H2,1-3H3 |
| InChIKey | XMJKRXAWRYGECD-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |