C20H18Cl2N2OS — CID 42845997
4-(4-chlorophenoxy)-2-[(3-chlorophenyl)methylsulfanyl]-6-propan-2-ylpyrimidine (PubChem CID 42845997) has the molecular formula C20H18Cl2N2OS and a molecular weight of 405.35 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-2-[(3-chlorophenyl)methylsulfanyl]-6-propan-2-ylpyrimidine.
| Compound Name | 4-(4-chlorophenoxy)-2-[(3-chlorophenyl)methylsulfanyl]-6-propan-2-ylpyrimidine |
|---|---|
| PubChem CID | 42845997 |
| Molecular Formula | C20H18Cl2N2OS |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 4-(4-chlorophenoxy)-2-[(3-chlorophenyl)methylsulfanyl]-6-propan-2-ylpyrimidine |
| SMILES | CC(C)c1cc(Oc2ccc(Cl)cc2)nc(SCc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C20H18Cl2N2OS/c1-13(2)18-11-19(25-17-8-6-15(21)7-9-17)24-20(23-18)26-12-14-4-3-5-16(22)10-14/h3-11,13H,12H2,1-2H3 |
| InChIKey | HVGJTTZFLIFVSY-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |