C21H20F2N2OS — CID 46033703
4-tert-butyl-6-(3-fluorophenoxy)-2-[(4-fluorophenyl)methylsulfanyl]pyrimidine (PubChem CID 46033703) has the molecular formula C21H20F2N2OS and a molecular weight of 386.47 g/mol. Its IUPAC name is 4-tert-butyl-6-(3-fluorophenoxy)-2-[(4-fluorophenyl)methylsulfanyl]pyrimidine.
| Compound Name | 4-tert-butyl-6-(3-fluorophenoxy)-2-[(4-fluorophenyl)methylsulfanyl]pyrimidine |
|---|---|
| PubChem CID | 46033703 |
| Molecular Formula | C21H20F2N2OS |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 4-tert-butyl-6-(3-fluorophenoxy)-2-[(4-fluorophenyl)methylsulfanyl]pyrimidine |
| SMILES | CC(C)(C)c1cc(Oc2cccc(F)c2)nc(SCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C21H20F2N2OS/c1-21(2,3)18-12-19(26-17-6-4-5-16(23)11-17)25-20(24-18)27-13-14-7-9-15(22)10-8-14/h4-12H,13H2,1-3H3 |
| InChIKey | ORZBINGUCLCYIQ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |