C21H23FN2O2 — CID 46036097
1-(2-fluoro-5-methylphenyl)-3-methyl-4-(3-phenylpropanoyl)piperazin-2-one (PubChem CID 46036097) has the molecular formula C21H23FN2O2 and a molecular weight of 354.43 g/mol. Its IUPAC name is 1-(2-fluoro-5-methylphenyl)-3-methyl-4-(3-phenylpropanoyl)piperazin-2-one.
| Compound Name | 1-(2-fluoro-5-methylphenyl)-3-methyl-4-(3-phenylpropanoyl)piperazin-2-one |
|---|---|
| PubChem CID | 46036097 |
| Molecular Formula | C21H23FN2O2 |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-(2-fluoro-5-methylphenyl)-3-methyl-4-(3-phenylpropanoyl)piperazin-2-one |
| SMILES | Cc1ccc(F)c(N2CCN(C(=O)CCc3ccccc3)C(C)C2=O)c1 |
| InChI | InChI=1S/C21H23FN2O2/c1-15-8-10-18(22)19(14-15)24-13-12-23(16(2)21(24)26)20(25)11-9-17-6-4-3-5-7-17/h3-8,10,14,16H,9,11-13H2,1-2H3 |
| InChIKey | QQXSSUBERATXIU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |