C20H21N3O4 — CID 93321618
(3S)-3-methyl-1-(4-nitrophenyl)-4-(3-phenylpropanoyl)piperazin-2-one (PubChem CID 93321618) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is (3S)-3-methyl-1-(4-nitrophenyl)-4-(3-phenylpropanoyl)piperazin-2-one.
| Compound Name | (3S)-3-methyl-1-(4-nitrophenyl)-4-(3-phenylpropanoyl)piperazin-2-one |
|---|---|
| PubChem CID | 93321618 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (3S)-3-methyl-1-(4-nitrophenyl)-4-(3-phenylpropanoyl)piperazin-2-one |
| SMILES | C[C@H]1C(=O)N(c2ccc([N+](=O)[O-])cc2)CCN1C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C20H21N3O4/c1-15-20(25)22(17-8-10-18(11-9-17)23(26)27)14-13-21(15)19(24)12-7-16-5-3-2-4-6-16/h2-6,8-11,15H,7,12-14H2,1H3/t15-/m0/s1 |
| InChIKey | GFGSOQYZVSMQIV-HNNXBMFYSA-N |
| XLogP | 2.79 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|