C19H17F3N2OS — CID 46039032
4-[(E)-but-2-enyl]-N-[[3-(trifluoromethyl)phenyl]methyl]thieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 46039032) has the molecular formula C19H17F3N2OS and a molecular weight of 378.42 g/mol. Its IUPAC name is 4-[(E)-but-2-enyl]-N-[[3-(trifluoromethyl)phenyl]methyl]thieno[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 4-[(E)-but-2-enyl]-N-[[3-(trifluoromethyl)phenyl]methyl]thieno[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 46039032 |
| Molecular Formula | C19H17F3N2OS |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 4-[(E)-but-2-enyl]-N-[[3-(trifluoromethyl)phenyl]methyl]thieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | C/C=C/Cn1c(C(=O)NCc2cccc(C(F)(F)F)c2)cc2sccc21 |
| InChI | InChI=1S/C19H17F3N2OS/c1-2-3-8-24-15-7-9-26-17(15)11-16(24)18(25)23-12-13-5-4-6-14(10-13)19(20,21)22/h2-7,9-11H,8,12H2,1H3,(H,23,25)/b3-2+ |
| InChIKey | MFCWPEZJXVHYLB-NSCUHMNNSA-N |
| XLogP | 5.23 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|