C16H20N2O2S — CID 93324353
4-[(E)-but-2-enyl]-N-[[(2R)-oxolan-2-yl]methyl]thieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 93324353) has the molecular formula C16H20N2O2S and a molecular weight of 304.41 g/mol. Its IUPAC name is 4-[(E)-but-2-enyl]-N-[[(2R)-oxolan-2-yl]methyl]thieno[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 4-[(E)-but-2-enyl]-N-[[(2R)-oxolan-2-yl]methyl]thieno[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 93324353 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 4-[(E)-but-2-enyl]-N-[[(2R)-oxolan-2-yl]methyl]thieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | C/C=C/Cn1c(C(=O)NC[C@H]2CCCO2)cc2sccc21 |
| InChI | InChI=1S/C16H20N2O2S/c1-2-3-7-18-13-6-9-21-15(13)10-14(18)16(19)17-11-12-5-4-8-20-12/h2-3,6,9-10,12H,4-5,7-8,11H2,1H3,(H,17,19)/b3-2+/t12-/m1/s1 |
| InChIKey | PNRSGKDUPUOYCB-QAVQXKDTSA-N |
| XLogP | 3.19 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|