C21H17BrN2OS — CID 46039899
N,4-dibenzyl-2-bromothieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 46039899) has the molecular formula C21H17BrN2OS and a molecular weight of 425.35 g/mol. Its IUPAC name is N,4-dibenzyl-2-bromothieno[3,2-b]pyrrole-5-carboxamide.
| Compound Name | N,4-dibenzyl-2-bromothieno[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 46039899 |
| Molecular Formula | C21H17BrN2OS |
| Molecular Weight | 425.35 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | N,4-dibenzyl-2-bromothieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1cc2sc(Br)cc2n1Cc1ccccc1 |
| InChI | InChI=1S/C21H17BrN2OS/c22-20-12-17-19(26-20)11-18(24(17)14-16-9-5-2-6-10-16)21(25)23-13-15-7-3-1-4-8-15/h1-12H,13-14H2,(H,23,25) |
| InChIKey | PBZWMUSHCWJJLT-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.35 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |