C16H14BrN3OS — CID 46039859
2-bromo-4-prop-2-enyl-N-(pyridin-4-ylmethyl)thieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 46039859) has the molecular formula C16H14BrN3OS and a molecular weight of 376.28 g/mol. Its IUPAC name is 2-bromo-4-prop-2-enyl-N-(pyridin-4-ylmethyl)thieno[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 2-bromo-4-prop-2-enyl-N-(pyridin-4-ylmethyl)thieno[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 46039859 |
| Molecular Formula | C16H14BrN3OS |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | 2-bromo-4-prop-2-enyl-N-(pyridin-4-ylmethyl)thieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | C=CCn1c(C(=O)NCc2ccncc2)cc2sc(Br)cc21 |
| InChI | InChI=1S/C16H14BrN3OS/c1-2-7-20-12-9-15(17)22-14(12)8-13(20)16(21)19-10-11-3-5-18-6-4-11/h2-6,8-9H,1,7,10H2,(H,19,21) |
| InChIKey | OTIFKKAKYWLTSO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|