C15H12BrN3O2 — CID 91959017
2-bromo-4-prop-2-enyl-N-pyridin-4-ylfuro[3,2-b]pyrrole-5-carboxamide (PubChem CID 91959017) has the molecular formula C15H12BrN3O2 and a molecular weight of 346.18 g/mol. Its IUPAC name is 2-bromo-4-prop-2-enyl-N-pyridin-4-ylfuro[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 2-bromo-4-prop-2-enyl-N-pyridin-4-ylfuro[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 91959017 |
| Molecular Formula | C15H12BrN3O2 |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 2-bromo-4-prop-2-enyl-N-pyridin-4-ylfuro[3,2-b]pyrrole-5-carboxamide |
| SMILES | C=CCn1c(C(=O)Nc2ccncc2)cc2oc(Br)cc21 |
| InChI | InChI=1S/C15H12BrN3O2/c1-2-7-19-11-9-14(16)21-13(11)8-12(19)15(20)18-10-3-5-17-6-4-10/h2-6,8-9H,1,7H2,(H,17,18,20) |
| InChIKey | PXLPFOMCDRJSCC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|