C18H19BrN4O2 — CID 91959028
2-bromo-N-[2-(1-cyclopropylethyl)pyrazol-3-yl]-4-prop-2-enylfuro[3,2-b]pyrrole-5-carboxamide (PubChem CID 91959028) has the molecular formula C18H19BrN4O2 and a molecular weight of 403.28 g/mol. Its IUPAC name is 2-bromo-N-[2-(1-cyclopropylethyl)pyrazol-3-yl]-4-prop-2-enylfuro[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 2-bromo-N-[2-(1-cyclopropylethyl)pyrazol-3-yl]-4-prop-2-enylfuro[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 91959028 |
| Molecular Formula | C18H19BrN4O2 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 2-bromo-N-[2-(1-cyclopropylethyl)pyrazol-3-yl]-4-prop-2-enylfuro[3,2-b]pyrrole-5-carboxamide |
| SMILES | C=CCn1c(C(=O)Nc2ccnn2C(C)C2CC2)cc2oc(Br)cc21 |
| InChI | InChI=1S/C18H19BrN4O2/c1-3-8-22-13-10-16(19)25-15(13)9-14(22)18(24)21-17-6-7-20-23(17)11(2)12-4-5-12/h3,6-7,9-12H,1,4-5,8H2,2H3,(H,21,24) |
| InChIKey | AGTPSKCZYRILNL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|