C16H19BrN2O2 — CID 91959016
(2-bromo-4-prop-2-enylfuro[3,2-b]pyrrol-5-yl)-(3-methylpiperidin-1-yl)methanone (PubChem CID 91959016) has the molecular formula C16H19BrN2O2 and a molecular weight of 351.24 g/mol. Its IUPAC name is (2-bromo-4-prop-2-enylfuro[3,2-b]pyrrol-5-yl)-(3-methylpiperidin-1-yl)methanone.
| Compound Name | (2-bromo-4-prop-2-enylfuro[3,2-b]pyrrol-5-yl)-(3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 91959016 |
| Molecular Formula | C16H19BrN2O2 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | (2-bromo-4-prop-2-enylfuro[3,2-b]pyrrol-5-yl)-(3-methylpiperidin-1-yl)methanone |
| SMILES | C=CCn1c(C(=O)N2CCCC(C)C2)cc2oc(Br)cc21 |
| InChI | InChI=1S/C16H19BrN2O2/c1-3-6-19-12-9-15(17)21-14(12)8-13(19)16(20)18-7-4-5-11(2)10-18/h3,8-9,11H,1,4-7,10H2,2H3 |
| InChIKey | YDRGTYBICHQUOM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 38.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|