C18H17BrN2O2S — CID 46040159
2-bromo-4-(2-phenoxyethyl)-N-prop-2-enylthieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 46040159) has the molecular formula C18H17BrN2O2S and a molecular weight of 405.32 g/mol. Its IUPAC name is 2-bromo-4-(2-phenoxyethyl)-N-prop-2-enylthieno[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 2-bromo-4-(2-phenoxyethyl)-N-prop-2-enylthieno[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 46040159 |
| Molecular Formula | C18H17BrN2O2S |
| Molecular Weight | 405.32 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | 2-bromo-4-(2-phenoxyethyl)-N-prop-2-enylthieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | C=CCNC(=O)c1cc2sc(Br)cc2n1CCOc1ccccc1 |
| InChI | InChI=1S/C18H17BrN2O2S/c1-2-8-20-18(22)15-11-16-14(12-17(19)24-16)21(15)9-10-23-13-6-4-3-5-7-13/h2-7,11-12H,1,8-10H2,(H,20,22) |
| InChIKey | YNYXUPHAXTYREB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.32 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|