C23H30N2O4S — CID 46043886
N-cyclohexyl-N,2-dimethyl-3-(3-phenoxyphenyl)-1,2-oxazolidine-4-sulfonamide (PubChem CID 46043886) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is N-cyclohexyl-N,2-dimethyl-3-(3-phenoxyphenyl)-1,2-oxazolidine-4-sulfonamide.
| Compound Name | N-cyclohexyl-N,2-dimethyl-3-(3-phenoxyphenyl)-1,2-oxazolidine-4-sulfonamide |
|---|---|
| PubChem CID | 46043886 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N-cyclohexyl-N,2-dimethyl-3-(3-phenoxyphenyl)-1,2-oxazolidine-4-sulfonamide |
| SMILES | CN1OCC(S(=O)(=O)N(C)C2CCCCC2)C1c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C23H30N2O4S/c1-24-23(18-10-9-15-21(16-18)29-20-13-7-4-8-14-20)22(17-28-24)30(26,27)25(2)19-11-5-3-6-12-19/h4,7-10,13-16,19,22-23H,3,5-6,11-12,17H2,1-2H3 |
| InChIKey | YMOOZXQHLAYDSE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |