C25H29N3O4S — CID 93000274
(3S,4S)-N-[4-(dimethylamino)phenyl]-2-methyl-3-(3-phenylmethoxyphenyl)-1,2-oxazolidine-4-sulfonamide (PubChem CID 93000274) has the molecular formula C25H29N3O4S and a molecular weight of 467.59 g/mol. Its IUPAC name is (3S,4S)-N-[4-(dimethylamino)phenyl]-2-methyl-3-(3-phenylmethoxyphenyl)-1,2-oxazolidine-4-sulfonamide.
| Compound Name | (3S,4S)-N-[4-(dimethylamino)phenyl]-2-methyl-3-(3-phenylmethoxyphenyl)-1,2-oxazolidine-4-sulfonamide |
|---|---|
| PubChem CID | 93000274 |
| Molecular Formula | C25H29N3O4S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | (3S,4S)-N-[4-(dimethylamino)phenyl]-2-methyl-3-(3-phenylmethoxyphenyl)-1,2-oxazolidine-4-sulfonamide |
| SMILES | CN(C)c1ccc(NS(=O)(=O)[C@@H]2CON(C)[C@H]2c2cccc(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H29N3O4S/c1-27(2)22-14-12-21(13-15-22)26-33(29,30)24-18-32-28(3)25(24)20-10-7-11-23(16-20)31-17-19-8-5-4-6-9-19/h4-16,24-26H,17-18H2,1-3H3/t24-,25+/m1/s1 |
| InChIKey | CKQAICHGEPQUSC-RPBOFIJWSA-N |
| XLogP | 4.06 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|