C20H21N3O3 — CID 46044295
N-benzyl-2-[4-(3-methylphenyl)-2,6-dioxo-1,3-diazinan-1-yl]acetamide (PubChem CID 46044295) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-benzyl-2-[4-(3-methylphenyl)-2,6-dioxo-1,3-diazinan-1-yl]acetamide.
| Compound Name | N-benzyl-2-[4-(3-methylphenyl)-2,6-dioxo-1,3-diazinan-1-yl]acetamide |
|---|---|
| PubChem CID | 46044295 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-benzyl-2-[4-(3-methylphenyl)-2,6-dioxo-1,3-diazinan-1-yl]acetamide |
| SMILES | Cc1cccc(C2CC(=O)N(CC(=O)NCc3ccccc3)C(=O)N2)c1 |
| InChI | InChI=1S/C20H21N3O3/c1-14-6-5-9-16(10-14)17-11-19(25)23(20(26)22-17)13-18(24)21-12-15-7-3-2-4-8-15/h2-10,17H,11-13H2,1H3,(H,21,24)(H,22,26) |
| InChIKey | HYDCVGMZEKGXJI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |