C31H30N2O3 — CID 46046116
2-[4-[benzyl-(2-phenoxyacetyl)amino]phenyl]-N-(2-phenylethyl)acetamide (PubChem CID 46046116) has the molecular formula C31H30N2O3 and a molecular weight of 478.59 g/mol. Its IUPAC name is 2-[4-[benzyl-(2-phenoxyacetyl)amino]phenyl]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[4-[benzyl-(2-phenoxyacetyl)amino]phenyl]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 46046116 |
| Molecular Formula | C31H30N2O3 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 2-[4-[benzyl-(2-phenoxyacetyl)amino]phenyl]-N-(2-phenylethyl)acetamide |
| SMILES | O=C(Cc1ccc(N(Cc2ccccc2)C(=O)COc2ccccc2)cc1)NCCc1ccccc1 |
| InChI | InChI=1S/C31H30N2O3/c34-30(32-21-20-25-10-4-1-5-11-25)22-26-16-18-28(19-17-26)33(23-27-12-6-2-7-13-27)31(35)24-36-29-14-8-3-9-15-29/h1-19H,20-24H2,(H,32,34) |
| InChIKey | XZTVLUFCBGYKQQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |