C29H27N3O3 — CID 46046119
2-[4-[benzyl-(2-phenoxyacetyl)amino]phenyl]-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 46046119) has the molecular formula C29H27N3O3 and a molecular weight of 465.55 g/mol. Its IUPAC name is 2-[4-[benzyl-(2-phenoxyacetyl)amino]phenyl]-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-[4-[benzyl-(2-phenoxyacetyl)amino]phenyl]-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 46046119 |
| Molecular Formula | C29H27N3O3 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 2-[4-[benzyl-(2-phenoxyacetyl)amino]phenyl]-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | O=C(Cc1ccc(N(Cc2ccccc2)C(=O)COc2ccccc2)cc1)NCc1ccccn1 |
| InChI | InChI=1S/C29H27N3O3/c33-28(31-20-25-11-7-8-18-30-25)19-23-14-16-26(17-15-23)32(21-24-9-3-1-4-10-24)29(34)22-35-27-12-5-2-6-13-27/h1-18H,19-22H2,(H,31,33) |
| InChIKey | KCRGVYFEUHXUEY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |