C23H29ClN2O — CID 46048250
N-[1-[(3-chlorophenyl)methyl]piperidin-4-yl]-N-(3-methylphenyl)butanamide (PubChem CID 46048250) has the molecular formula C23H29ClN2O and a molecular weight of 384.95 g/mol. Its IUPAC name is N-[1-[(3-chlorophenyl)methyl]piperidin-4-yl]-N-(3-methylphenyl)butanamide.
| Compound Name | N-[1-[(3-chlorophenyl)methyl]piperidin-4-yl]-N-(3-methylphenyl)butanamide |
|---|---|
| PubChem CID | 46048250 |
| Molecular Formula | C23H29ClN2O |
| Molecular Weight | 384.95 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-[1-[(3-chlorophenyl)methyl]piperidin-4-yl]-N-(3-methylphenyl)butanamide |
| SMILES | CCCC(=O)N(c1cccc(C)c1)C1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C23H29ClN2O/c1-3-6-23(27)26(22-10-4-7-18(2)15-22)21-11-13-25(14-12-21)17-19-8-5-9-20(24)16-19/h4-5,7-10,15-16,21H,3,6,11-14,17H2,1-2H3 |
| InChIKey | UYKDECBHYCMDJM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.95 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |