C24H33N3O3 — CID 46054543
N-(3,4-dimethoxyphenyl)-N-[1-[[4-(dimethylamino)phenyl]methyl]piperidin-4-yl]acetamide (PubChem CID 46054543) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-N-[1-[[4-(dimethylamino)phenyl]methyl]piperidin-4-yl]acetamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-N-[1-[[4-(dimethylamino)phenyl]methyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 46054543 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-N-[1-[[4-(dimethylamino)phenyl]methyl]piperidin-4-yl]acetamide |
| SMILES | COc1ccc(N(C(C)=O)C2CCN(Cc3ccc(N(C)C)cc3)CC2)cc1OC |
| InChI | InChI=1S/C24H33N3O3/c1-18(28)27(22-10-11-23(29-4)24(16-22)30-5)21-12-14-26(15-13-21)17-19-6-8-20(9-7-19)25(2)3/h6-11,16,21H,12-15,17H2,1-5H3 |
| InChIKey | VLHPUWIMOFBSTD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|