C23H27N5O3 — CID 4605472
5-(2-hydroxy-3-piperidin-1-ylpropoxy)-N,1-diphenyltriazole-4-carboxamide (PubChem CID 4605472) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is 5-(2-hydroxy-3-piperidin-1-ylpropoxy)-N,1-diphenyltriazole-4-carboxamide.
| Compound Name | 5-(2-hydroxy-3-piperidin-1-ylpropoxy)-N,1-diphenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 4605472 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 5-(2-hydroxy-3-piperidin-1-ylpropoxy)-N,1-diphenyltriazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1nnn(-c2ccccc2)c1OCC(O)CN1CCCCC1 |
| InChI | InChI=1S/C23H27N5O3/c29-20(16-27-14-8-3-9-15-27)17-31-23-21(22(30)24-18-10-4-1-5-11-18)25-26-28(23)19-12-6-2-7-13-19/h1-2,4-7,10-13,20,29H,3,8-9,14-17H2,(H,24,30) |
| InChIKey | ZPTZWGUKROOLTJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |