C23H25ClN2O3S — CID 46055225
4-chloro-N-[1-(furan-2-ylmethyl)piperidin-4-yl]-N-(4-methylphenyl)benzenesulfonamide (PubChem CID 46055225) has the molecular formula C23H25ClN2O3S and a molecular weight of 444.98 g/mol. Its IUPAC name is 4-chloro-N-[1-(furan-2-ylmethyl)piperidin-4-yl]-N-(4-methylphenyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-[1-(furan-2-ylmethyl)piperidin-4-yl]-N-(4-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 46055225 |
| Molecular Formula | C23H25ClN2O3S |
| Molecular Weight | 444.98 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 4-chloro-N-[1-(furan-2-ylmethyl)piperidin-4-yl]-N-(4-methylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(N(C2CCN(Cc3ccco3)CC2)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H25ClN2O3S/c1-18-4-8-20(9-5-18)26(30(27,28)23-10-6-19(24)7-11-23)21-12-14-25(15-13-21)17-22-3-2-16-29-22/h2-11,16,21H,12-15,17H2,1H3 |
| InChIKey | DBNKQAZACYORAT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.98 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |