C17H16F2N4O3 — CID 46060671
3-(2,4-difluorophenyl)-1-(2-methoxyethyl)-7-prop-2-enylpurine-2,6-dione (PubChem CID 46060671) has the molecular formula C17H16F2N4O3 and a molecular weight of 362.34 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-1-(2-methoxyethyl)-7-prop-2-enylpurine-2,6-dione.
| Compound Name | 3-(2,4-difluorophenyl)-1-(2-methoxyethyl)-7-prop-2-enylpurine-2,6-dione |
|---|---|
| PubChem CID | 46060671 |
| Molecular Formula | C17H16F2N4O3 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 3-(2,4-difluorophenyl)-1-(2-methoxyethyl)-7-prop-2-enylpurine-2,6-dione |
| SMILES | C=CCn1cnc2c1c(=O)n(CCOC)c(=O)n2-c1ccc(F)cc1F |
| InChI | InChI=1S/C17H16F2N4O3/c1-3-6-21-10-20-15-14(21)16(24)22(7-8-26-2)17(25)23(15)13-5-4-11(18)9-12(13)19/h3-5,9-10H,1,6-8H2,2H3 |
| InChIKey | YAVGAWRGDXPVQP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|