C26H21ClN4O3 — CID 46060765
1-benzyl-7-[(3-chlorophenyl)methyl]-3-(3-methoxyphenyl)purine-2,6-dione (PubChem CID 46060765) has the molecular formula C26H21ClN4O3 and a molecular weight of 472.93 g/mol. Its IUPAC name is 1-benzyl-7-[(3-chlorophenyl)methyl]-3-(3-methoxyphenyl)purine-2,6-dione.
| Compound Name | 1-benzyl-7-[(3-chlorophenyl)methyl]-3-(3-methoxyphenyl)purine-2,6-dione |
|---|---|
| PubChem CID | 46060765 |
| Molecular Formula | C26H21ClN4O3 |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 1-benzyl-7-[(3-chlorophenyl)methyl]-3-(3-methoxyphenyl)purine-2,6-dione |
| SMILES | COc1cccc(-n2c(=O)n(Cc3ccccc3)c(=O)c3c2ncn3Cc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C26H21ClN4O3/c1-34-22-12-6-11-21(14-22)31-24-23(29(17-28-24)15-19-9-5-10-20(27)13-19)25(32)30(26(31)33)16-18-7-3-2-4-8-18/h2-14,17H,15-16H2,1H3 |
| InChIKey | SXQMQEDTGWHQIN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |