C20H27N3O4S — CID 46067944
[2-[4-(2-methoxyethoxy)phenyl]-1,3-thiazol-4-yl]-[4-(2-methoxyethyl)piperazin-1-yl]methanone (PubChem CID 46067944) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is [2-[4-(2-methoxyethoxy)phenyl]-1,3-thiazol-4-yl]-[4-(2-methoxyethyl)piperazin-1-yl]methanone.
| Compound Name | [2-[4-(2-methoxyethoxy)phenyl]-1,3-thiazol-4-yl]-[4-(2-methoxyethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46067944 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | [2-[4-(2-methoxyethoxy)phenyl]-1,3-thiazol-4-yl]-[4-(2-methoxyethyl)piperazin-1-yl]methanone |
| SMILES | COCCOc1ccc(-c2nc(C(=O)N3CCN(CCOC)CC3)cs2)cc1 |
| InChI | InChI=1S/C20H27N3O4S/c1-25-12-11-22-7-9-23(10-8-22)20(24)18-15-28-19(21-18)16-3-5-17(6-4-16)27-14-13-26-2/h3-6,15H,7-14H2,1-2H3 |
| InChIKey | KIJUMUCKAMSPFE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|