C25H22F2N4O4 — CID 46069810
N-[2-[3-[(3,4-difluorophenyl)methyl]-2-oxo-1,3-diazinan-1-yl]phenyl]-4-methyl-3-nitrobenzamide (PubChem CID 46069810) has the molecular formula C25H22F2N4O4 and a molecular weight of 480.47 g/mol. Its IUPAC name is N-[2-[3-[(3,4-difluorophenyl)methyl]-2-oxo-1,3-diazinan-1-yl]phenyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[2-[3-[(3,4-difluorophenyl)methyl]-2-oxo-1,3-diazinan-1-yl]phenyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 46069810 |
| Molecular Formula | C25H22F2N4O4 |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | N-[2-[3-[(3,4-difluorophenyl)methyl]-2-oxo-1,3-diazinan-1-yl]phenyl]-4-methyl-3-nitrobenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2N2CCCN(Cc3ccc(F)c(F)c3)C2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H22F2N4O4/c1-16-7-9-18(14-23(16)31(34)35)24(32)28-21-5-2-3-6-22(21)30-12-4-11-29(25(30)33)15-17-8-10-19(26)20(27)13-17/h2-3,5-10,13-14H,4,11-12,15H2,1H3,(H,28,32) |
| InChIKey | HTUGURIMRKKXRX-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|