C27H25F3N4O4 — CID 46070396
4-methyl-N-[5-methyl-2-[2-oxo-3-[[3-(trifluoromethyl)phenyl]methyl]-1,3-diazinan-1-yl]phenyl]-3-nitrobenzamide (PubChem CID 46070396) has the molecular formula C27H25F3N4O4 and a molecular weight of 526.52 g/mol. Its IUPAC name is 4-methyl-N-[5-methyl-2-[2-oxo-3-[[3-(trifluoromethyl)phenyl]methyl]-1,3-diazinan-1-yl]phenyl]-3-nitrobenzamide.
| Compound Name | 4-methyl-N-[5-methyl-2-[2-oxo-3-[[3-(trifluoromethyl)phenyl]methyl]-1,3-diazinan-1-yl]phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 46070396 |
| Molecular Formula | C27H25F3N4O4 |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | 4-methyl-N-[5-methyl-2-[2-oxo-3-[[3-(trifluoromethyl)phenyl]methyl]-1,3-diazinan-1-yl]phenyl]-3-nitrobenzamide |
| SMILES | Cc1ccc(N2CCCN(Cc3cccc(C(F)(F)F)c3)C2=O)c(NC(=O)c2ccc(C)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C27H25F3N4O4/c1-17-7-10-23(22(13-17)31-25(35)20-9-8-18(2)24(15-20)34(37)38)33-12-4-11-32(26(33)36)16-19-5-3-6-21(14-19)27(28,29)30/h3,5-10,13-15H,4,11-12,16H2,1-2H3,(H,31,35) |
| InChIKey | NJSDEBVLUIIETG-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|