C24H24FN5O4 — CID 46072363
4-[4-(2-fluorophenoxy)-6-[(2-nitrophenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]morpholine (PubChem CID 46072363) has the molecular formula C24H24FN5O4 and a molecular weight of 465.49 g/mol. Its IUPAC name is 4-[4-(2-fluorophenoxy)-6-[(2-nitrophenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]morpholine.
| Compound Name | 4-[4-(2-fluorophenoxy)-6-[(2-nitrophenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]morpholine |
|---|---|
| PubChem CID | 46072363 |
| Molecular Formula | C24H24FN5O4 |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 4-[4-(2-fluorophenoxy)-6-[(2-nitrophenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]morpholine |
| SMILES | O=[N+]([O-])c1ccccc1CN1CCc2nc(N3CCOCC3)nc(Oc3ccccc3F)c2C1 |
| InChI | InChI=1S/C24H24FN5O4/c25-19-6-2-4-8-22(19)34-23-18-16-28(15-17-5-1-3-7-21(17)30(31)32)10-9-20(18)26-24(27-23)29-11-13-33-14-12-29/h1-8H,9-16H2 |
| InChIKey | ZQXQGHFZAWSMCD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 93.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|